Introduction:Basic information about CAS 852-19-7|4-amino-N-(5-methyl-2-phenylpyrazol-3-yl)benzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-amino-N-(5-methyl-2-phenylpyrazol-3-yl)benzenesulfonamide |
|---|
| CAS Number | 852-19-7 | Molecular Weight | 328.38900 |
|---|
| Density | 1.36 g/cm3 | Boiling Point | 544.5ºC at 760mmHg |
|---|
| Molecular Formula | C16H16N4O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 283.1ºC |
|---|
Names
| Name | 4-amino-N-(5-methyl-2-phenylpyrazol-3-yl)benzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.36 g/cm3 |
|---|
| Boiling Point | 544.5ºC at 760mmHg |
|---|
| Molecular Formula | C16H16N4O2S |
|---|
| Molecular Weight | 328.38900 |
|---|
| Flash Point | 283.1ºC |
|---|
| Exact Mass | 328.09900 |
|---|
| PSA | 98.39000 |
|---|
| LogP | 4.29870 |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | MTERSQYMYBGZTP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)n(-c2ccccc2)n1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 5-(4-Aminobenzolsulfonylamino)-3-methyl-1-phenylpyrazol |
| 5-Sulfanilylamino-3-methyl-1-phenyl-pyrazol |
| Vesulong vet. |
| SULFAZAMET |
| sulfamethylphenazole |
| Sulphapyrazole |
| 4-amino-N-(5-methyl-2-phenyl-2H-pyrazol-3-yl)-benzenesulfonamide |
| Sulfapyrazolum |
| sulfapyrazole |
| Solfapirazolo [DCIT] |
| sulfanilic acid-(5-methyl-2-phenyl-2H-pyrazol-3-ylamide) |
| Sulfapirazol |
| Sulfanilsaeure-(5-methyl-2-phenyl-2H-pyrazol-3-ylamid) |
| Sulfapyrazol |
| Solfapirazolo |