Introduction：Basic information about CAS 56211-43-9|Tameticillin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tameticillin |
|---|
| CAS Number | 56211-43-9 | Molecular Weight | 479.59000 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 644.5ºC at 760 mmHg |
|---|
| Molecular Formula | C23H33N3O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 343.6ºC |
|---|
Names
| Name | 2-(diethylamino)ethyl (2S,5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 644.5ºC at 760 mmHg |
|---|
| Molecular Formula | C23H33N3O6S |
|---|
| Molecular Weight | 479.59000 |
|---|
| Flash Point | 343.6ºC |
|---|
| Exact Mass | 479.20900 |
|---|
| PSA | 126.20000 |
|---|
| LogP | 2.26220 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | HBOSVRMWGCNXAB-LVCYWYKZSA-N |
|---|
| SMILES | CCN(CC)CCOC(=O)C1N2C(=O)C(NC(=O)c3c(OC)cccc3OC)C2SC1(C)C |
|---|
Synonyms
| 2-(diethylamino)ethyl(2s,5r,6r)-6-(2,6-dimethoxybenzamido)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| Tameticilline |
| Tameticillin |
| Tameticilina |
| Tamethicillin |
| Tameticillin [INN] |
| Tameticillinum |
