Introduction：Basic information about CAS 113079-82-6|Terbequinil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Terbequinil |
|---|
| CAS Number | 113079-82-6 | Molecular Weight | 274.31500 |
|---|
| Density | 1.181g/cm3 | Boiling Point | 446.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 224ºC |
|---|
Names
| Name | 1-(methoxymethyl)-4-oxo-N-propylquinoline-3-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.181g/cm3 |
|---|
| Boiling Point | 446.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18N2O3 |
|---|
| Molecular Weight | 274.31500 |
|---|
| Flash Point | 224ºC |
|---|
| Exact Mass | 274.13200 |
|---|
| PSA | 63.82000 |
|---|
| LogP | 2.32000 |
|---|
| Vapour Pressure | 3.56E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | RIPDGZHPNKQLDC-UHFFFAOYSA-N |
|---|
| SMILES | CCCNC(=O)c1cn(COC)c2ccccc2c1=O |
|---|
Synonyms
| Terbequinilum |
| 1,4-Dihydro-1-(methoxymethyl)-4-oxo-N-propyl-3-quinolinecarboxamide |
| Terbequinilo [INN-Spanish] |
| 3-Quinolinecarboxamide,1,4-dihydro-1-(methoxymethyl)-4-oxo-N-propyl |
| 1-Methoxymethyl-4-oxo-1,4-dihydroquinoline 3-(N-propyl)carboxamide |
| Terbequinilum [INN-Latin] |
| Terbequinil |
| Terbequinilo |
