Introduction：Basic information about CAS 86433-40-1|Terflavoxate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Terflavoxate |
|---|
| CAS Number | 86433-40-1 | Molecular Weight | 419.51300 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 573ºC at 760 mmHg |
|---|
| Molecular Formula | C26H29NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 300.3ºC |
|---|
Names
| Name | (2-methyl-1-piperidin-1-ylpropan-2-yl) 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 573ºC at 760 mmHg |
|---|
| Molecular Formula | C26H29NO4 |
|---|
| Molecular Weight | 419.51300 |
|---|
| Flash Point | 300.3ºC |
|---|
| Exact Mass | 419.21000 |
|---|
| PSA | 59.75000 |
|---|
| LogP | 5.12760 |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | VQTYZZPDAFGNCK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)OC(C)(C)CN3CCCCC3)cccc2c1=O |
|---|
Synonyms
| Terflavoxate [INN] |
| UNII-NKF031O02G |
| Terflavoxate |
