Introduction：Basic information about CAS 108832-16-2|2,4-dichloro-7-methoxy-3-phenylquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-dichloro-7-methoxy-3-phenylquinoline |
|---|
| CAS Number | 108832-16-2 | Molecular Weight | 304.17100 |
|---|
| Density | 1.322g/cm3 | Boiling Point | 399ºC at 760mmHg |
|---|
| Molecular Formula | C16H11Cl2NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.1ºC |
|---|
Names
| Name | 2,4-dichloro-7-methoxy-3-phenylquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.322g/cm3 |
|---|
| Boiling Point | 399ºC at 760mmHg |
|---|
| Molecular Formula | C16H11Cl2NO |
|---|
| Molecular Weight | 304.17100 |
|---|
| Flash Point | 195.1ºC |
|---|
| Exact Mass | 303.02200 |
|---|
| PSA | 22.12000 |
|---|
| LogP | 5.21720 |
|---|
| Vapour Pressure | 3.27E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | CFBPNDXUUDXHPZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(Cl)c(-c3ccccc3)c(Cl)nc2c1 |
|---|
Synonyms
| 2,4-dichloro-3-phenyl-7-methoxyquinoline |
| 2,4-dichloro-7-methoxy-3-phenyl-quinoline |
| 2,4-dichloro-3-phenylquinolin-7-yl methyl ether |
