Introduction：Basic information about CAS 1196157-65-9|Resorufin-d6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Resorufin-d6 |
|---|
| CAS Number | 1196157-65-9 | Molecular Weight | 219.23 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12HD6NO3 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1,2,4,6,8,9-hexadeuterio-7-hydroxyphenoxazin-3-one |
|---|
| Synonym | More Synonyms |
|---|
Resorufin-d6 BiologicalActivity
Chemical & Physical Properties
| Molecular Formula | C12HD6NO3 |
|---|
| Molecular Weight | 219.23 |
|---|
| Exact Mass | 219.08000 |
|---|
| PSA | 63.33000 |
|---|
| LogP | 1.99840 |
|---|
| InChIKey | HSSLDCABUXLXKM-MZWXYZOWSA-N |
|---|
| SMILES | O=c1ccc2nc3ccc(O)cc3oc-2c1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 7-Hydroxy-3H-phenoxazin-3-one-d6 |
| Resorufin-d6 |
