Introduction：Basic information about CAS 1196157-72-8|Sulfathiazole-13C6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sulfathiazole-13C6 |
|---|
| CAS Number | 1196157-72-8 | Molecular Weight | 261.27300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H9N3O2S2 | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|
Chemical & Physical Properties
| Molecular Formula | C9H9N3O2S2 |
|---|
| Molecular Weight | 261.27300 |
|---|
| Exact Mass | 261.03400 |
|---|
| PSA | 121.70000 |
|---|
| LogP | 3.26110 |
|---|
| InChIKey | JNMRHUJNCSQMMB-UQUYMPKGSA-N |
|---|
| SMILES | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
