Introduction：Basic information about CAS 886371-05-7|1-(2,4-difluorophenyl)-2,2,2-trifluoroethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2,4-difluorophenyl)-2,2,2-trifluoroethanone |
|---|
| CAS Number | 886371-05-7 | Molecular Weight | 210.10100 |
|---|
| Density | 1.441g/cm3 | Boiling Point | 173.7ºC at 760 mmHg |
|---|
| Molecular Formula | C8H3F5O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 62.9ºC |
|---|
Names
| Name | 1-(2,4-difluorophenyl)-2,2,2-trifluoroethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.441g/cm3 |
|---|
| Boiling Point | 173.7ºC at 760 mmHg |
|---|
| Molecular Formula | C8H3F5O |
|---|
| Molecular Weight | 210.10100 |
|---|
| Flash Point | 62.9ºC |
|---|
| Exact Mass | 210.01000 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 2.70980 |
|---|
| Index of Refraction | 1.417 |
|---|
| InChIKey | JMRMOPRHHLTLDG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccc(F)cc1F)C(F)(F)F |
|---|
Synonyms
| 2,2'-[9h-fluoren-9-ylidene-bis(4,1-phenyleneoxy-2,1-ethanediyloxymethylene)]bis-oxirane |
| 2,2,2,2',4'-pentafluoroacetophenone |
