Introduction：Basic information about CAS 175870-21-0|Dehydro Silodosin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dehydro Silodosin |
|---|
| CAS Number | 175870-21-0 | Molecular Weight | 493.519 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 650.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H30F3N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 347.0±31.5 °C |
|---|
Names
| Name | 1-(3-hydroxypropyl)-5-[(2R)-2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indole-7-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 650.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H30F3N3O4 |
|---|
| Molecular Weight | 493.519 |
|---|
| Flash Point | 347.0±31.5 °C |
|---|
| Exact Mass | 493.218842 |
|---|
| PSA | 99.73000 |
|---|
| LogP | 2.98 |
|---|
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.560 |
|---|
| InChIKey | VICSLOHTZDWOFF-QGZVFWFLSA-N |
|---|
| SMILES | CC(Cc1cc(C(N)=O)c2c(ccn2CCCO)c1)NCCOc1ccccc1OCC(F)(F)F |
|---|
Synonyms
| Dihydro Silodosin |
| 1H-Indole-7-carboxamide, 1-(3-hydroxypropyl)-5-[(2R)-2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]- |
| 1-(3-Hydroxypropyl)-5-[(2R)-2-({2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl}amino)propyl]-1H-indole-7-carboxamide |
| Dehydro Silodosin |
