Introduction:Basic information about CAS 292068-77-0|5-tert-butoxycarbonylamino-benzo[b]thiophene-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-tert-butoxycarbonylamino-benzo[b]thiophene-2-carboxylic acid |
|---|
| CAS Number | 292068-77-0 | Molecular Weight | 293.33800 |
|---|
| Density | 1.367g/cm3 | Boiling Point | 440.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.2ºC |
|---|
Names
| Name | 5-tert-butoxycarbonylamino-benzo[b]thiophene-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.367g/cm3 |
|---|
| Boiling Point | 440.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO4S |
|---|
| Molecular Weight | 293.33800 |
|---|
| Flash Point | 220.2ºC |
|---|
| Exact Mass | 293.07200 |
|---|
| PSA | 103.87000 |
|---|
| LogP | 4.01950 |
|---|
| Vapour Pressure | 1.55E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.66 |
|---|
| InChIKey | GLLFQKVJBXZJON-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)Nc1ccc2sc(C(=O)O)cc2c1 |
|---|