Introduction:Basic information about CAS 1031-15-8|Methyl(triphenyl)phosphonium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl(triphenyl)phosphonium chloride |
|---|
| CAS Number | 1031-15-8 | Molecular Weight | 312.773 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H18ClP | Melting Point | 221°C (dec.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS05, GHS07, GHS09 | Signal Word | Danger |
|---|
Names
| Name | Methyltriphenylphosphonium chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 221°C (dec.) |
|---|
| Molecular Formula | C19H18ClP |
|---|
| Molecular Weight | 312.773 |
|---|
| Exact Mass | 312.083466 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 0.61430 |
|---|
| InChIKey | QRPRIOOKPZSVFN-UHFFFAOYSA-M |
|---|
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
|---|
Safety Information
| Symbol | GHS05, GHS07, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302 + H312-H315-H318-H411 |
|---|
| Precautionary Statements | P273-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
|---|
| Risk Phrases | R21/22;R38;R41;R51/53 |
|---|
| Safety Phrases | S22-S26-S36/37/39-S61 |
|---|
| RIDADR | UN 3077 |
|---|
| Hazard Class | 9.0 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| methyl(triphenyl)phosphanium,chloride |
| EINECS 418-400-2 |
| MFCD00797851 |
| Methyl(triphenyl)phosphonium chloride |
| Phosphonium, methyltriphenyl-, chloride (1:1) |
| Methyl triphenyl phosphonium chloride |