Introduction：Basic information about CAS 14376-16-0|2-[[4-(hydroxymethylcarbamoylsulfamoyl)phenyl]carbamoyl]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[[4-(hydroxymethylcarbamoylsulfamoyl)phenyl]carbamoyl]benzoic acid |
|---|
| CAS Number | 14376-16-0 | Molecular Weight | 393.37100 |
|---|
| Density | 1.564g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C16H15N3O7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-[[4-(hydroxymethylcarbamoylsulfamoyl)phenyl]carbamoyl]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.564g/cm3 |
|---|
| Molecular Formula | C16H15N3O7S |
|---|
| Molecular Weight | 393.37100 |
|---|
| Exact Mass | 393.06300 |
|---|
| PSA | 170.28000 |
|---|
| LogP | 2.51040 |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | UPCBSVILVWKHIG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(NCO)NS(=O)(=O)c1ccc(NC(=O)c2ccccc2C(=O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| Acido sulfaloxico |
| Intestin-Euvernil |
| Acide sulfaloxique |
| Sulfaloxic acid |
| Enteromide |
| Sulfaloxinsaeure |
| Sulphaloxic acid |
| Acidum sulfaloxicum |
