Introduction:Basic information about CAS 66558-73-4|N,N',N''-[(2,4,6,8,8-pentamethylcyclotetrasiloxane-2,4,6-triyl) tr, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N',N''-[(2,4,6,8,8-pentamethylcyclotetrasiloxane-2,4,6-triyl) tris(oxy)]tris[N-ethyl-Ethanamine |
|---|
| CAS Number | 66558-73-4 | Molecular Weight | 515.89700 |
|---|
| Density | 1.04g/cm3 | Boiling Point | 383.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H45N3O7Si4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.9ºC |
|---|
Names
| Name | N-[[4,6-bis(diethylaminooxy)-2,4,6,8,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]-N-ethylethanamine |
|---|
Chemical & Physical Properties
| Density | 1.04g/cm3 |
|---|
| Boiling Point | 383.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H45N3O7Si4 |
|---|
| Molecular Weight | 515.89700 |
|---|
| Flash Point | 185.9ºC |
|---|
| Exact Mass | 515.23300 |
|---|
| PSA | 74.33000 |
|---|
| LogP | 3.29450 |
|---|
| Index of Refraction | 1.469 |
|---|
| InChIKey | NNKYYXDDIBUNPM-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)O[Si]1(C)O[Si](C)(C)O[Si](C)(ON(CC)CC)O[Si](C)(ON(CC)CC)O1 |
|---|