Introduction:Basic information about CAS 17894-26-7|2,5-dimethoxy-3-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-dimethoxy-3-nitrobenzoic acid |
|---|
| CAS Number | 17894-26-7 | Molecular Weight | 227.17100 |
|---|
| Density | / | Boiling Point | 427.5ºC at 760mmHg |
|---|
| Molecular Formula | C9H9NO6 | Melting Point | 183-187 °C(lit.) |
|---|
| MSDS | USA | Flash Point | 212.3ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2,5-dimethoxy-3-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 427.5ºC at 760mmHg |
|---|
| Melting Point | 183-187 °C(lit.) |
|---|
| Molecular Formula | C9H9NO6 |
|---|
| Molecular Weight | 227.17100 |
|---|
| Flash Point | 212.3ºC |
|---|
| Exact Mass | 227.04300 |
|---|
| PSA | 101.58000 |
|---|
| LogP | 1.83340 |
|---|
| Vapour Pressure | 4.55E-08mmHg at 25°C |
|---|
| InChIKey | QCJROOYLFVYZEP-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(=O)O)c(OC)c([N+](=O)[O-])c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,4-DIHYDROXYBENZOIC ACID ETHANOLAMIDE |
| MFCD00017022 |
| Dimethylaether-3-nitro-gentisinsaeure |
| 3-Nitro-2,5-dimethoxy-bezoic acid |
| 2,5-Dimethoxy-3-nitrobenzoic Acid |
| 2,5-Dimethoxy-3-nitro-benzoesaeure |
| 2,5-Dimethoxy-3-nitro benzoic acid |