Introduction：Basic information about CAS 69804-48-4|4,4'-Bis((2-hydroxyethyl)methylamino)benzophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Bis((2-hydroxyethyl)methylamino)benzophenone |
|---|
| CAS Number | 69804-48-4 | Molecular Weight | 328.40500 |
|---|
| Density | 1.227g/cm3 | Boiling Point | 598.6ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 315.8ºC |
|---|
Names
| Name | bis[4-[2-hydroxyethyl(methyl)amino]phenyl]methanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.227g/cm3 |
|---|
| Boiling Point | 598.6ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24N2O3 |
|---|
| Molecular Weight | 328.40500 |
|---|
| Flash Point | 315.8ºC |
|---|
| Exact Mass | 328.17900 |
|---|
| PSA | 64.01000 |
|---|
| LogP | 1.77460 |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | SVIDPUWUNCALBH-UHFFFAOYSA-N |
|---|
| SMILES | CN(CCO)c1ccc(C(=O)c2ccc(N(C)CCO)cc2)cc1 |
|---|
Synonyms
| 4,4'-Bis((2-hydroxyethyl)methylamino)benzophenone |
| bis[4-[(2-hydroxyethyl)methylamino]phenyl]-methanone |
| Bis{4-[(2-hydroxyethyl)(methyl)amino]phenyl}methanone |
| Methanone, bis[4-[(2-hydroxyethyl)methylamino]phenyl]- |
| EINECS 274-124-0 |
