Introduction：Basic information about CAS 93858-25-4|4-[[5-[[4-chloro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]di, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[[5-[[4-chloro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-oxo-1-(4-sulfophenyl)-4H-pyrazole-3-carboxylic acid |
|---|
| CAS Number | 93858-25-4 | Molecular Weight | 768.11200 |
|---|
| Density | 1.95g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C25H18ClN9O12S3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-[[5-[[4-chloro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-oxo-1-(4-sulfophenyl)-4H-pyrazole-3-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.95g/cm3 |
|---|
| Molecular Formula | C25H18ClN9O12S3 |
|---|
| Molecular Weight | 768.11200 |
|---|
| Exact Mass | 766.99300 |
|---|
| PSA | 352.13000 |
|---|
| LogP | 4.27880 |
|---|
| Index of Refraction | 1.828 |
|---|
| InChIKey | QMKVGLRKOOGFPU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1N=Nc1cc(Nc2nc(Cl)nc(Nc3cccc(S(=O)(=O)O)c3)n2)ccc1S(=O)(=O)O |
|---|
