Introduction:Basic information about CAS 50594-82-6|3,4,5-Trichlorobenzotrifluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4,5-Trichlorobenzotrifluoride |
|---|
| CAS Number | 50594-82-6 | Molecular Weight | 249.445 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 202.2±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H2Cl3F3 | Melting Point | -10--8 °C |
|---|
| MSDS | / | Flash Point | 98.3±0.0 °C |
|---|
Names
| Name | 3,4,5-Trichlorobenzotrifluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 202.2±35.0 °C at 760 mmHg |
|---|
| Melting Point | -10--8 °C |
|---|
| Molecular Formula | C7H2Cl3F3 |
|---|
| Molecular Weight | 249.445 |
|---|
| Flash Point | 98.3±0.0 °C |
|---|
| Exact Mass | 247.917419 |
|---|
| LogP | 4.80 |
|---|
| Vapour Pressure | 0.4±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.490 |
|---|
| InChIKey | FBKFIAIRSQOXJR-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1cc(Cl)c(Cl)c(Cl)c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/38 |
|---|
| Safety Phrases | S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2903999090 |
|---|
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3,4,5-Trichlorobenzo |
| 3,4,5-Trichlorobenzotrifluoride |
| 3,4,5-Trichloro-1-trifluoromethylbenzene |
| 2,6-dichloro-4-trifluoromethylchlorobenzene |
| EINECS 256-636-6 |
| 3,4,5-trichlorotrifluoromethylnenzene |
| 3,4,5-Trichlorotrifluoromethylbenzene |
| 1,2,3-Trichloro-5-(trifluoromethyl)benzene |
| Benzene, 1,2,3-trichloro-5-(trifluoromethyl)- |
| 3,4,5-TRICHLOROTRIFLUORIDE |
| 3,4,5-Trichloro-3,5-dinitrobenzotrifluoride |
| MFCD00035985 |
| 3,4,5-Trichloro benzotrifluoride |