Introduction:Basic information about CAS 6240-01-3|3-amino-1-adamantanecarboxylic acid hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-amino-1-adamantanecarboxylic acid hydrochloride |
|---|
| CAS Number | 6240-01-3 | Molecular Weight | 231.719 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H18ClNO2 | Melting Point | >300ºC (DEC.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-aminoadamantane-1-carboxylic acid,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | >300ºC (DEC.) |
|---|
| Molecular Formula | C11H18ClNO2 |
|---|
| Molecular Weight | 231.719 |
|---|
| Exact Mass | 231.102600 |
|---|
| PSA | 63.32000 |
|---|
| LogP | 2.87100 |
|---|
| InChIKey | CMUAQGBJDDHTPE-UHFFFAOYSA-N |
|---|
| SMILES | Cl.NC12CC3CC(C1)CC(C(=O)O)(C3)C2 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2922499990 |
|---|
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Tricyclo[3.3.1.1]decane-1-carboxylic acid, 3-amino-, (5R,7S)-, hydrochloride (1:1) |
| 1-aminoadamantane-3-carboxylic acid hydrochloride |
| 3-Amino-1-adamantanecarboxylic acid hydrochloride (1:1) |
| 3-amino-adamantane-1-carboxylic acid hydrochloride |
| Tricyclo[3.3.1.1]decane-1-carboxylic acid, 3-amino-, hydrochloride (1:1) |
| (1r,3s,5R,7S)-3-Amino-1-adamantanecarboxylic acid hydrochloride (1:1) |
| 3-Aminoadamantane-1-carboxylic acid hydrochloride (1:1) |
| 3-Amino-1-adamantanecarboxylicacidhydrochloride |
| 3-amino-1-adamantanecarboxylic acid hydrochloride |
| 3-Aminoadamantane-1-carboxylic Acid Hydrochloride |