Introduction:Basic information about CAS 17607-28-2|N-Acetyl-3-fluorophenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Acetyl-3-fluorophenylalanine |
|---|
| CAS Number | 17607-28-2 | Molecular Weight | 225.216 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 450.2±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H12FNO3 | Melting Point | 154-157 °C(lit.) |
|---|
| MSDS | / | Flash Point | 226.1±27.3 °C |
|---|
Names
| Name | 2-acetamido-3-(3-fluorophenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 450.2±40.0 °C at 760 mmHg |
|---|
| Melting Point | 154-157 °C(lit.) |
|---|
| Molecular Formula | C11H12FNO3 |
|---|
| Molecular Weight | 225.216 |
|---|
| Flash Point | 226.1±27.3 °C |
|---|
| Exact Mass | 225.080124 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 0.83 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.532 |
|---|
| InChIKey | LKXNJLVPYPXTDY-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)NC(Cc1cccc(F)c1)C(=O)O |
|---|
| Storage condition | Keep Cold |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-Acetyl-3-fluoro-DL-phenylalanine |
| (R)-N-acetyl-3-fluorophenylalanine |
| 2-(acetylamino)-3-(3-fluorophenyl)propanoic acid |
| N-Acetyl-m-fluoro-D-phenylalanin |
| N-Acetyl-3-fluorophenylalanine |
| Phenylalanine, N-acetyl-3-fluoro- |
| EINECS 241-579-1 |
| N-acetyl-3-fluorophenylalanine methyl ester |
| MFCD00017920 |
| N-Acetyl-3-fluor-D-phenylalanin |
| N-acetyl-3-fluoro-D-phenylalanine |