Introduction：Basic information about CAS 66818-54-0|[2,2,3,3,4,4,5,5-octafluoro-6-(2-methylprop-2-enoyloxy)hexyl] 2-methylprop-2-e, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [2,2,3,3,4,4,5,5-octafluoro-6-(2-methylprop-2-enoyloxy)hexyl] 2-methylprop-2-enoate |
|---|
| CAS Number | 66818-54-0 | Molecular Weight | 398.24600 |
|---|
| Density | 1.231g/cm3 | Boiling Point | 107ºC 0,9mm |
|---|
| Molecular Formula | C14H14F8O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 52.931ºC |
|---|
Names
| Name | [2,2,3,3,4,4,5,5-octafluoro-6-(2-methylprop-2-enoyloxy)hexyl] 2-methylprop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.231g/cm3 |
|---|
| Boiling Point | 107ºC 0,9mm |
|---|
| Molecular Formula | C14H14F8O4 |
|---|
| Molecular Weight | 398.24600 |
|---|
| Flash Point | 52.931ºC |
|---|
| Exact Mass | 398.07600 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.76620 |
|---|
| Index of Refraction | 1.445 |
|---|
| InChIKey | JTNUTCQSBBMBTF-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)COC(=O)C(=C)C |
|---|
Synonyms
| 2,2,3,3,4,4,5,5-OCTAFLUORO-1,6-HEXANEDIOL |
| PC5628 |
| 2,2,3,3,4,4,5,5-octafluoro-1,6-hexyl dimethacrylate |
