Introduction：Basic information about CAS 1701-19-5|8-methyl-2-(trifluoromethyl)quinolin-4-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-methyl-2-(trifluoromethyl)quinolin-4-ol |
|---|
| CAS Number | 1701-19-5 | Molecular Weight | 227.182 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 245.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H8F3NO | Melting Point | 125-131°C |
|---|
| MSDS | ChineseUSA | Flash Point | 102.4±27.3 °C |
|---|
Names
| Name | 8-methyl-2-(trifluoromethyl)-1H-quinolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 245.6±40.0 °C at 760 mmHg |
|---|
| Melting Point | 125-131°C |
|---|
| Molecular Formula | C11H8F3NO |
|---|
| Molecular Weight | 227.182 |
|---|
| Flash Point | 102.4±27.3 °C |
|---|
| Exact Mass | 227.055801 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 4.73 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.515 |
|---|
| InChIKey | HLPDICBGZTVELB-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc2c(=O)cc(C(F)(F)F)[nH]c12 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-Hydroxy-8-methyl-2-trifluormethylchinolin |
| 8-methyl-2-(trifluoromethyl)quinolin-4-ol |
| MFCD00276592 |
| 2-trifluoromethyl-4-hydroxy-8-methylquinoline |
| 8-Methyl-2-(trifluoromethyl)-4(1H)-quinolinone |
| 4(1H)-Quinolinone, 8-methyl-2-(trifluoromethyl)- |
| 4-Hydroxy-8-methyl-2-(trifluoromethyl)quinoline |
