Introduction：Basic information about CAS 321309-36-8|5-(2-thienyl)nicotinoyl chloride hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(2-thienyl)nicotinoyl chloride hydrochloride |
|---|
| CAS Number | 321309-36-8 | Molecular Weight | 260.14000 |
|---|
| Density | 1.365g/cm3 | Boiling Point | 366.8ºC at 760mmHg |
|---|
| Molecular Formula | C10H7Cl2NOS | Melting Point | 215ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-(2-thienyl)nicotinoyl chloride hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.365g/cm3 |
|---|
| Boiling Point | 366.8ºC at 760mmHg |
|---|
| Melting Point | 215ºC |
|---|
| Molecular Formula | C10H7Cl2NOS |
|---|
| Molecular Weight | 260.14000 |
|---|
| Exact Mass | 258.96300 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 3.99110 |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | OEBSOEFGKXIREA-UHFFFAOYSA-N |
|---|
| SMILES | Cl.O=C(Cl)c1cncc(-c2cccs2)c1 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
Synonyms
| 5-(2-thienyl)nicotinoylchlorideHCl |
| 5-(Thien-2-yl)nicotinoyl chloride |
