CAS 24424-99-5|Di-tert-butyl dicarbonate
Introduction：Basic information about CAS 24424-99-5|Di-tert-butyl dicarbonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Di-tert-butyl dicarbonate | ||
|---|---|---|---|
| CAS Number | 24424-99-5 | Molecular Weight | 218.247 |
| Density | 0.949 | Boiling Point | 56-57 ºC (0.5 torr) |
| Molecular Formula | C10H18O5 | Melting Point | 23 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 37 ºC |
| Symbol | GHS02, GHS05, GHS06 | Signal Word | Danger |
Names
| Name | tert-butoxycarbonyl anhydride |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 0.949 |
|---|---|
| Boiling Point | 56-57 ºC (0.5 torr) |
| Melting Point | 23 °C(lit.) |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.247 |
| Flash Point | 37 ºC |
| Exact Mass | 218.115417 |
| PSA | 61.83000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±0.4 mmHg at 25°C |
| Index of Refraction | 1.431 |
| InChIKey | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
Safety Information
| Symbol | GHS02, GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H226-H315-H317-H318-H330-H335 |
| Supplemental HS | May form explosive peroxides. |
| Precautionary Statements | P210-P260-P280-P304 + P340 + P310-P305 + P351 + P338 + P310-P370 + P378 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T+,T,F,Xi,F+ |
| Risk Phrases | R10;R26;R36/37/38;R43 |
| Safety Phrases | S16;S24;S37/39;S45 |
| RIDADR | UN 2929 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | HT0230000 |
| Packaging Group | I |
| Hazard Class | 6.1 |
| HS Code | 29209010 |
Customs
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
Articles36
More Articles| Sialidases as regulators of bioengineered cellular surfaces. Glycobiology 25 , 784-91, (2015) Human sialidases (NEUs) catalyze the removal of N-acetyl neuraminic acids from the glycome of the cell and regulate a diverse repertoire of nominal cellular functions, such as cell signaling and adhes... | |
| Mixed alkyl aryl phosphonate esters as quenched fluorescent activity-based probes for serine proteases. Org. Biomol. Chem. 13(8) , 2293-9, (2015) Activity-based probes (ABPs) are powerful tools for the analysis of active enzyme species in whole proteomes, cells or animals. Quenched fluorescent ABPs (qABPs) can be applied for real time imaging, ... | |
| Regioselective chemical and rapid enzymatic synthesis of a novel redox – Antiproliferative molecular hybrid. Eur. J. Med. Chem. 96 , 47-57, (2015) Recent science evidenced the interlinkage of oxidative stress and cancer. Due to the inherent complexity of cancer and its accompanying effect of oxidative stress, novel molecules, containing combinat... |
Synonyms
| BOC-anhydride |
| DBDC |
| EINECS 246-240-1 |
| Carbonic acid, (1,1-dimethylethoxy)carbonyl 1,1-dimethylethyl ester |
| Boc2O |
| DIBOC,BOC |
| Dibutyldicarbonate |
| Di-tert-butyl dicarbonate |
| Pyrocarbonic Acid Di-tert-butyl Ester |
| Di-tert-butyl Pyrocarbonate |
| Di-tert-butyldicarbonat |
| Di-tert-Butyldicarbonate |
| di(tert-butyl) carbonate |
| Di(tert-butyl) dicarbonate |
| DIBOC |
| boc-acidanhydride |
| Bis(2-methyl-2-propanyl) dicarbonate |
| di-t-Butyl dicarbonate |
| BOC |
| MFCD00008805 |
| Bis(tert-butoxycarbonyl)oxide |
| di-t-butylpyrocarbonate |
| BOC anhydride |
