Introduction:Basic information about CAS 37456-21-6|6,8-di(tert-butyl)-4-oxo-4h-chromene-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6,8-di(tert-butyl)-4-oxo-4h-chromene-2-carboxylic acid |
|---|
| CAS Number | 37456-21-6 | Molecular Weight | 302.36500 |
|---|
| Density | 1.159g/cm3 | Boiling Point | 402.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H22O4 | Melting Point | 229ºC |
|---|
| MSDS | / | Flash Point | 138.3ºC |
|---|
Names
| Name | 6,8-di(tert-butyl)-4-oxo-4h-chromene-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.159g/cm3 |
|---|
| Boiling Point | 402.8ºC at 760 mmHg |
|---|
| Melting Point | 229ºC |
|---|
| Molecular Formula | C18H22O4 |
|---|
| Molecular Weight | 302.36500 |
|---|
| Flash Point | 138.3ºC |
|---|
| Exact Mass | 302.15200 |
|---|
| PSA | 67.51000 |
|---|
| LogP | 4.08620 |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | CJTURQGHQPDNDA-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(C(=O)O)cc(=O)c2c1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 6,8-Di(tert-butyl)-4-oxo-4H-1-benzopyran-2-carboxylic acid |
| terbucromil |
| 6,8-Di-t-butyl-4-oxo-4H-1-benzopyran-2-carbonsaeure |
| 6,8-di-t-butyl-4-oxo-4H-1-benzopyran-2-carboxylic acid |
| 6,8-di-tert-butyl-4-oxo-4H-chromene-2-carboxylic acid |