Introduction：Basic information about CAS 103011-38-7|3-(1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride |
|---|
| CAS Number | 103011-38-7 | Molecular Weight | 254.71100 |
|---|
| Density | 1.58g/cm3 | Boiling Point | 365.3ºC at 760mmHg |
|---|
| Molecular Formula | C7H7ClO4S2 | Melting Point | 93ºC |
|---|
| MSDS | USA | Flash Point | 174.7ºC |
|---|
Names
| Name | 3-(1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.58g/cm3 |
|---|
| Boiling Point | 365.3ºC at 760mmHg |
|---|
| Melting Point | 93ºC |
|---|
| Molecular Formula | C7H7ClO4S2 |
|---|
| Molecular Weight | 254.71100 |
|---|
| Flash Point | 174.7ºC |
|---|
| Exact Mass | 253.94700 |
|---|
| PSA | 89.22000 |
|---|
| LogP | 2.80180 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | RRTOURREASJQSR-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1sccc1C1OCCO1 |
|---|
Synonyms
| 3-(1,3-dioxolan-2-yl)-thiophene-2-sulfonyl chloride |
| chloro(3-(1,3-dioxolan-2-yl)(2-thienyl))sulfone |
