Introduction：Basic information about CAS 295349-62-1|tert-Butyl 2-chloroisonicotinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl 2-chloroisonicotinate |
|---|
| CAS Number | 295349-62-1 | Molecular Weight | 213.661 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 287.4±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H12ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 127.6±21.8 °C |
|---|
Names
| Name | tert-butyl 2-chloropyridine-4-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 287.4±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H12ClNO2 |
|---|
| Molecular Weight | 213.661 |
|---|
| Flash Point | 127.6±21.8 °C |
|---|
| Exact Mass | 213.055649 |
|---|
| PSA | 39.19000 |
|---|
| LogP | 2.84 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.515 |
|---|
| InChIKey | FPUSSPQEUANTGI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)c1ccnc(Cl)c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-chloroisonicotinic acid tert-butyl ester |
| 2-Methyl-2-propanyl 2-chloroisonicotinate |
| 2-Chloropyridine-4-carboxylic acid tert-butyl ester |
| 4-Pyridinecarboxylic acid, 2-chloro-, 1,1-dimethylethyl ester |
| tert.-butyl 2-chloroisonicotinoate |
| tert-Butyl 2-chloropyridine-4-carboxylate |
| 2-Chloro-4-pyridinecarboxylic acid 1,1-dimethylethyl ester |
| MFCD03411667 |
| 2-Chloro-4-pyridinecarboxylicacid1,1-dimethylethylester |
| tert-Butyl 2-chloroisonicotinate |
| 2-Chloro-4-pyridinecaroboxylicacidmethylester |
| tert-Butyl-2-chlorpyridin-4-carboxylat |
