Introduction：Basic information about CAS 22117-85-7|2-Methoxy-5-sulfamoylbenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methoxy-5-sulfamoylbenzoic acid |
|---|
| CAS Number | 22117-85-7 | Molecular Weight | 231.22600 |
|---|
| Density | 1.25 g/mL at 25 °C(lit.) | Boiling Point | 82-85 °C11 mm Hg(lit.) |
|---|
| Molecular Formula | C8H9NO5S | Melting Point | 82-85°C(11 mmHg) |
|---|
| MSDS | / | Flash Point | 205 °F |
|---|
Names
| Name | 2-Methoxy-5-sulfamoylbenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25 g/mL at 25 °C(lit.) |
|---|
| Boiling Point | 82-85 °C11 mm Hg(lit.) |
|---|
| Melting Point | 82-85°C(11 mmHg) |
|---|
| Molecular Formula | C8H9NO5S |
|---|
| Molecular Weight | 231.22600 |
|---|
| Flash Point | 205 °F |
|---|
| Exact Mass | 231.02000 |
|---|
| PSA | 115.07000 |
|---|
| LogP | 1.82190 |
|---|
| Vapour Pressure | 4.04E-10mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.511(lit.) |
|---|
| InChIKey | SQAILWDRVDGLGY-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)O |
|---|
| Water Solubility | insoluble |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2935009090 |
|---|
Preparation
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 2-Methoxy-benzoesaeure-sulfonamid-(5) |
| 2-Methoxy-5-sulfonylbenzoic acid |
| MFCD00129997 |
| 2-Methoxy-5-Sulfamoylbenzoic Acid |
| 5-Sulphamoyl-o-anisic acid |
| 6-methoxy-3-sulfamoylbenzoic acid |
| 2-Methoxy-5-sulfamoyl-benzoesaeure |
| 5-Aminosulfonyl-2-methoxybenzoic acid |
| 2-methoxy-5-sulphamoyl-benzoic acid |
| 2-methoxy-5-sulfamoyl-benzoic acid |
| EINECS 244-789-1 |
