Introduction：Basic information about CAS 6002-34-2|tert-Butyl(diphenyl)phosphine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl(diphenyl)phosphine |
|---|
| CAS Number | 6002-34-2 | Molecular Weight | 242.296 |
|---|
| Density | / | Boiling Point | 320.5±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H19P | Melting Point | 52-55ºC(lit.) |
|---|
| MSDS | Chinese | Flash Point | 154.4±25.6 °C |
|---|
Names
| Name | tert-Butyldiphenylphosphine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 320.5±11.0 °C at 760 mmHg |
|---|
| Melting Point | 52-55ºC(lit.) |
|---|
| Molecular Formula | C16H19P |
|---|
| Molecular Weight | 242.296 |
|---|
| Flash Point | 154.4±25.6 °C |
|---|
| Exact Mass | 242.122437 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 5.55 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| InChIKey | QZUPHAGRBBOLTB-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)P(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2902909090 |
|---|
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| Phosphine, (1,1-dimethylethyl)diphenyl- |
| tert-butyl(diphenyl)phosphane |
| tert-Butyl(diphenyl)phosphine |
| EINECS 227-848-6 |
| (2-Methyl-2-propanyl)(diphenyl)phosphine |
| MFCD00015004 |
