Introduction:Basic information about CAS 10347-88-3|3-tert-butylhexanedioic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-tert-butylhexanedioic acid |
|---|
| CAS Number | 10347-88-3 | Molecular Weight | 202.247 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 352.4±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H18O4 | Melting Point | 112-115ºC(lit.) |
|---|
| MSDS | / | Flash Point | 181.1±16.9 °C |
|---|
Names
| Name | 3-tert-butylhexanedioic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 352.4±15.0 °C at 760 mmHg |
|---|
| Melting Point | 112-115ºC(lit.) |
|---|
| Molecular Formula | C10H18O4 |
|---|
| Molecular Weight | 202.247 |
|---|
| Flash Point | 181.1±16.9 °C |
|---|
| Exact Mass | 202.120514 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.65 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.473 |
|---|
| InChIKey | LHSCNQRBIIDZCB-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)C(CCC(=O)O)CC(=O)O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-(tert-Butyl)hexanedioic acid |
| 3-tert-Butyl-adipinsaeure |
| 2-tert-butyl-1,4-butanedicarboxylic acid |
| 3-tert-butylhexanedioic acid |
| EINECS 233-759-3 |
| 3-t-Butyl-hexanedioic acid |
| Hexanedioic acid, 3-(1,1-dimethylethyl)- |
| MFCD00020550 |
| 3-(2-Methyl-2-propanyl)hexanedioic acid |