Introduction：Basic information about CAS 627-82-7|3,3'-Oxydipropan-1,2-diol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3'-Oxydipropan-1,2-diol |
|---|
| CAS Number | 627-82-7 | Molecular Weight | 166.172 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 407.0±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H14O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 200.0±27.3 °C |
|---|
Names
| Name | 3-(2,3-dihydroxypropoxy)propane-1,2-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 407.0±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H14O5 |
|---|
| Molecular Weight | 166.172 |
|---|
| Flash Point | 200.0±27.3 °C |
|---|
| Exact Mass | 166.084122 |
|---|
| PSA | 90.15000 |
|---|
| LogP | -2.61 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.516 |
|---|
| InChIKey | GPLRAVKSCUXZTP-UHFFFAOYSA-N |
|---|
| SMILES | OCC(O)COCC(O)CO |
|---|
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2905399090 |
|---|
Customs
| HS Code | 2905399090 |
|---|
| Summary | 2905399090 other diols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
|---|
Synonyms
| 1,2-Propanediol, 3,3'-oxydi- |
| Q1YQ1O1YQ1Q |
| 3,3'-Oxydi(1,2-propanediol) |
| 1,2-Propanediol, 3,3'-oxybis- |
| 3,3'-Oxydi-1,2-propanediol |
| 3,3'-Oxydipropan-1,2-diol |
| 3,2-propanediol |
| EINECS 211-013-8 |
| Diglycerin |
| [14C]diglycerol |
| α,α'-Diglycerol |
| Diglycerine |
| bis-(2,3-dihydroxy-propyl)-ether |
| 4-Oxaheptane-1,2,6,7-tetrol |
| GPLRAVKSCUXZTP-UHFFFAOYSA |
| 3,3'-oxy-bis-propane-1,2-diol |
| 1,2-Propanediol,3,3'-oxybis |
| Glycerin-1-(2.3-dihydroxy-propylaether) |
| 3,3'-Oxydipropane-1,2-diol |
| MFCD00049316 |
| InChI=1/C6H14O5/c7-1-5(9)3-11-4-6(10)2-8/h5-10H,1-4H2 |
