Introduction：Basic information about CAS 17768-34-2|3-Bromoadamantane-1-acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Bromoadamantane-1-acetic acid |
|---|
| CAS Number | 17768-34-2 | Molecular Weight | 273.16600 |
|---|
| Density | 1.556g/cm3 | Boiling Point | 373.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H17BrO2 | Melting Point | 194-200ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 179.6ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3-Bromo-1-adamantaneacetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.556g/cm3 |
|---|
| Boiling Point | 373.3ºC at 760mmHg |
|---|
| Melting Point | 194-200ºC |
|---|
| Molecular Formula | C12H17BrO2 |
|---|
| Molecular Weight | 273.16600 |
|---|
| Flash Point | 179.6ºC |
|---|
| Exact Mass | 272.04100 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.19500 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| InChIKey | HFGLWCBEPPFDDJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC12CC3CC(CC(Br)(C3)C1)C2 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36 |
|---|
| Safety Phrases | 26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 3-Bromoadamantane-1-acetic acid |
| 3-Carboxymethyl-1-brom-adamantan |
| 3-BROMO-1-ADAMANTANEACETIC ACID |
| acide bromo-3 adamantylacetique |
