Introduction:Basic information about CAS 6259-50-3|6-(Dimethylamino)-4-hydroxy-2-naphthalenesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-(Dimethylamino)-4-hydroxy-2-naphthalenesulfonic acid |
|---|
| CAS Number | 6259-50-3 | Molecular Weight | 267.30100 |
|---|
| Density | 1.462g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H13NO4S | Melting Point | 251-252ºC (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-(dimethylamino)-4-hydroxynaphthalene-2-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.462g/cm3 |
|---|
| Melting Point | 251-252ºC (dec.)(lit.) |
|---|
| Molecular Formula | C12H13NO4S |
|---|
| Molecular Weight | 267.30100 |
|---|
| Exact Mass | 267.05700 |
|---|
| PSA | 86.22000 |
|---|
| LogP | 2.93890 |
|---|
| Index of Refraction | 1.683 |
|---|
| InChIKey | LRPIENHBUQIGPP-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc2cc(S(=O)(=O)O)cc(O)c2c1 |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-27-28-36/37/39-45 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-dimethylamino-4-hydroxy-naphthalene-2-sulfonic acid |
| HMS3078P23 |
| 6-Dimethylamino-4-hydroxy-naphthalin-2-sulfonsaeure |
| 6-Dimethylamino-4-hydroxy-2-naphthalenesulfonic acid |
| 7-(Dimethylamino)-1-naphthol-3-sulfonsaeure |
| 6-dimethylamino-4-hydroxy-2-naphthalenesulphonic acid |
| 7-Dimethylamino-naphthol-(1)-sulfonsaeure-(3) |
| 2-Naphthalenesulfonic acid,6-(dimethylamino)-4-hydroxy |
| MFCD00003972 |
| EINECS 228-404-4 |