Introduction:Basic information about CAS 28416-82-2|Flumethasone Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Flumethasone Acid |
|---|
| CAS Number | 28416-82-2 | Molecular Weight | 396.425 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 568.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H26F2O5 | Melting Point | 303-305ºC |
|---|
| MSDS | / | Flash Point | 297.6±30.1 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 568.4±50.0 °C at 760 mmHg |
|---|
| Melting Point | 303-305ºC |
|---|
| Molecular Formula | C21H26F2O5 |
|---|
| Molecular Weight | 396.425 |
|---|
| Flash Point | 297.6±30.1 °C |
|---|
| Exact Mass | 396.174835 |
|---|
| PSA | 94.83000 |
|---|
| LogP | 0.81 |
|---|
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | QSVBUQTYFQFEHC-YHODHBBHSA-N |
|---|
| SMILES | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P301 + P312 + P330-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | UN 3077 9 / PGIII |
|---|
Synonyms
| Androsta-1,4-diene-17-carboxylic acid, 6,9-difluoro-11,17-dihydroxy-16-methyl-3-oxo-, (6α,11β,16α,17α)- |
| (6a,11b,16a,17a)-6,9-Difluoro-11,17-dihydroxy-16-methyl-3-oxoandrosta-1,4-diene-17-carboxylic acid |
| (6α,11β,16α,17α)-6,9-Difluoro-11,17-dihydroxy-16-methyl-3-oxoandrosta-1,4-diene-17-carboxylic acid |
| flumethasone acid |
| (6S,8S,9R,10S,11S,13R,14S,17S)-17-acetyl-6,9-difluoro-11-hydroxy-10,13-dimethyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanth ren-3-one |
| Fluticasone Propionate Impurity 1 |