Introduction：Basic information about CAS 5280-80-8|3,3'-[(2,5-dimethyl-p-phenylene)bis[imino(1-acetyl-2-oxoethylene)azo]]bis[4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3'-[(2,5-dimethyl-p-phenylene)bis[imino(1-acetyl-2-oxoethylene)azo]]bis[4-chloro-N-(5-chloro-o-tolyl)benzamide] |
|---|
| CAS Number | 5280-80-8 | Molecular Weight | 916.63500 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 890.7ºC at 760mmHg |
|---|
| Molecular Formula | C44H38Cl4N8O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 492.5ºC |
|---|
Names
| Name | 4-chloro-3-[[1-[4-[[2-[[2-chloro-5-[(5-chloro-2-methylphenyl)carbamoyl]phenyl]diazenyl]-3-oxobutanoyl]amino]-2,5-dimethylanilino]-1,3-dioxobutan-2-yl]diazenyl]-N-(5-chloro-2-methylphenyl)benzamide |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 890.7ºC at 760mmHg |
|---|
| Molecular Formula | C44H38Cl4N8O6 |
|---|
| Molecular Weight | 916.63500 |
|---|
| Flash Point | 492.5ºC |
|---|
| Exact Mass | 914.16700 |
|---|
| PSA | 199.98000 |
|---|
| LogP | 11.69040 |
|---|
| Index of Refraction | 1.659 |
|---|
| InChIKey | MLIPLRICHBJSFY-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)C(N=Nc1cc(C(=O)Nc2cc(Cl)ccc2C)ccc1Cl)C(=O)Nc1cc(C)c(NC(=O)C(N=Nc2cc(C(=O)Nc3cc(Cl)ccc3C)ccc2Cl)C(C)=O)cc1C |
|---|
