Introduction：Basic information about CAS 6972-78-7|TCMDC-123469, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | TCMDC-123469 |
|---|
| CAS Number | 6972-78-7 | Molecular Weight | 170.126 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C5H6N4O3 | Melting Point | >300ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 6-Amino-1-Methyl-5-Nitrosouracil |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Melting Point | >300ºC(lit.) |
|---|
| Molecular Formula | C5H6N4O3 |
|---|
| Molecular Weight | 170.126 |
|---|
| Exact Mass | 170.043991 |
|---|
| PSA | 110.31000 |
|---|
| LogP | -1.53 |
|---|
| Index of Refraction | 1.742 |
|---|
| InChIKey | AHOWVSJPUQTRNN-UHFFFAOYSA-N |
|---|
| SMILES | Cn1c(N)c(N=O)c(=O)[nH]c1=O |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-amino-1-methyl-5-nitrosopyrimidine-2,4-dione |
| 2,4(1H,3H)-Pyrimidinedione, 6-amino-1-methyl-5-nitroso- |
| TCMDC-123469 |
| 6-Amino-1-methyl-5-nitrosouracil |
| EINECS 230-213-6 |
| MFCD01104056 |
| 6-Amino-1-methyl-5-nitroso-2,4(1H,3H)-pyrimidinedione |
| 6-amino-1-methyl-5-nitrosopyrimidine-2,4(1H,3H)-dione |
