Introduction:Basic information about CAS 416885-45-5|2-(4-chloro-5-methyl-2-nitrophenoxy)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-chloro-5-methyl-2-nitrophenoxy)acetic acid |
|---|
| CAS Number | 416885-45-5 | Molecular Weight | 245.61700 |
|---|
| Density | 1.491g/cm3 | Boiling Point | 434.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H8ClNO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.3ºC |
|---|
Names
| Name | 2-(4-chloro-5-methyl-2-nitrophenoxy)acetic acid |
|---|
Chemical & Physical Properties
| Density | 1.491g/cm3 |
|---|
| Boiling Point | 434.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H8ClNO5 |
|---|
| Molecular Weight | 245.61700 |
|---|
| Flash Point | 216.3ºC |
|---|
| Exact Mass | 245.00900 |
|---|
| PSA | 92.35000 |
|---|
| LogP | 2.54320 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | PQAJOTWEIQHUIQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(OCC(=O)O)c([N+](=O)[O-])cc1Cl |
|---|