Introduction：Basic information about CAS 24779-68-8|Adamantan-1-ylmalonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Adamantan-1-ylmalonic acid |
|---|
| CAS Number | 24779-68-8 | Molecular Weight | 238.280 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 438.3±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18O4 | Melting Point | 188-192ºC |
|---|
| MSDS | / | Flash Point | 233.0±20.5 °C |
|---|
Names
| Name | 2-(1-adamantyl)propanedioic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 438.3±28.0 °C at 760 mmHg |
|---|
| Melting Point | 188-192ºC |
|---|
| Molecular Formula | C13H18O4 |
|---|
| Molecular Weight | 238.280 |
|---|
| Flash Point | 233.0±20.5 °C |
|---|
| Exact Mass | 238.120514 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 2.67 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | PJDWEIFODWCDAV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(C(=O)O)C12CC3CC(CC(C3)C1)C2 |
|---|
Safety Information
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Adamantan-1-ylmalonic acid |
| 2-ADAMANTAN-1-YL-MALONIC ACID |
| 1-adamantylmalonic acid |
| 2-adamantanylpropanedioic acid |
| Adamant-1-yl-malonsaeure |
| 1-Adamantylmalonsaeure |
| Propanedioic acid, 2-tricyclo[3.3.1.1]dec-1-yl- |
