Introduction：Basic information about CAS 5623-45-0|bis(2,4,6-trimethylphenyl)methanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(2,4,6-trimethylphenyl)methanone |
|---|
| CAS Number | 5623-45-0 | Molecular Weight | 266.37700 |
|---|
| Density | 1.004g/cm3 | Boiling Point | 340.6ºC at 760mmHg |
|---|
| Molecular Formula | C19H22O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 141.2ºC |
|---|
Names
| Name | bis(2,4,6-trimethylphenyl)methanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.004g/cm3 |
|---|
| Boiling Point | 340.6ºC at 760mmHg |
|---|
| Molecular Formula | C19H22O |
|---|
| Molecular Weight | 266.37700 |
|---|
| Flash Point | 141.2ºC |
|---|
| Exact Mass | 266.16700 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.76800 |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | SKMUIZHHMAPKIV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
|---|
Synonyms
| EINECS 227-052-9 |
| 2,4,6,2',4',6'-Hexamethyl-benzophenon |
| 2,2',4,4',6,6'-Hexamethylbenzophenone |
| 2,4,6,2',4',6'-hexamethyl-benzophenone |
| dimesitylketone |
