Introduction:Basic information about CAS 606-80-4|1,1'-BIPHENYL]-2,4'-DICARBOXYLIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1'-BIPHENYL]-2,4'-DICARBOXYLIC ACID |
|---|
| CAS Number | 606-80-4 | Molecular Weight | 242.22700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H10O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(4-carboxyphenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H10O4 |
|---|
| Molecular Weight | 242.22700 |
|---|
| Exact Mass | 242.05800 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 2.75000 |
|---|
| InChIKey | WKSIHEZXQNJQCB-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(-c2ccccc2C(=O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2,4'-biphenyl-dicarboxylate acid |
| 2,4'-H2bpdc |
| [1,1'-Biphenyl]-2,4'-dicarboxylic acid |
| biphenyl-2,4'-dicarboxylic acid |
| 2,4'-Biphenyldicarboxylic Acid |