Introduction：Basic information about CAS 56119-96-1|Furodazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Furodazole |
|---|
| CAS Number | 56119-96-1 | Molecular Weight | 265.26700 |
|---|
| Density | 1.368g/cm3 | Boiling Point | 513.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 264.5ºC |
|---|
Names
| Name | 2-(furan-2-yl)-7-methyl-3,6-dihydroimidazo[4,5-f]quinolin-9-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.368g/cm3 |
|---|
| Boiling Point | 513.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11N3O2 |
|---|
| Molecular Weight | 265.26700 |
|---|
| Flash Point | 264.5ºC |
|---|
| Exact Mass | 265.08500 |
|---|
| PSA | 74.94000 |
|---|
| LogP | 3.38510 |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | NYRSQWAKUMYFLI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)c2c(ccc3[nH]c(-c4ccco4)nc32)[nH]1 |
|---|
Synonyms
| F-691 |
| Furodazole anhydrous |
| Furodazole |
| Furodazole (USAN/INN) |
| 2-(2-Furyl)-7-methyl-1H-imidazo[4,5-f]quinolin-9-ol |
| 2-furan-2-yl-7-methyl-1(3),6-dihydro-imidazo[4,5-f]quinolin-9-one |
| UNII-5B6I19ZE0R |
| UNII-9745E7HEBG |
