Introduction：Basic information about CAS 66608-32-0|Imcarbofos, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Imcarbofos |
|---|
| CAS Number | 66608-32-0 | Molecular Weight | 528.52000 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 565.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H30N4O7P2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 295.9ºC |
|---|
Names
| Name | 1-diethoxyphosphoryl-3-[4-(diethoxyphosphorylcarbamothioylamino)-2-methoxyphenyl]thiourea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 565.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H30N4O7P2S2 |
|---|
| Molecular Weight | 528.52000 |
|---|
| Flash Point | 295.9ºC |
|---|
| Exact Mass | 528.10300 |
|---|
| PSA | 212.21000 |
|---|
| LogP | 5.55800 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | ZEFLNAWBWJVMFX-UHFFFAOYSA-N |
|---|
| SMILES | CCOP(=O)(NC(=S)Nc1ccc(NC(=S)NP(=O)(OCC)OCC)c(OC)c1)OCC |
|---|
Synonyms
| 3-Methoxy-N,N'-bis-(N-diethoxyphosphoryl-thiocarbamoyl)-1,4-phenylendiamin |
| UNII-21H450VP7K |
| Imcarbofos (USAN/INN) |
| Imcarbofos |
| Imcarbofosum |
