Introduction：Basic information about CAS 227617-70-1|1-butyl-2,3-dimethylimidazol-3-ium,hexafluorophosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-butyl-2,3-dimethylimidazol-3-ium,hexafluorophosphate |
|---|
| CAS Number | 227617-70-1 | Molecular Weight | 153.244 |
|---|
| Density | 1.354 | Boiling Point | / |
|---|
| Molecular Formula | C9H17F6N2P | Melting Point | 50ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-butyl-2,3-dimethylimidazol-3-ium,hexafluorophosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.354 |
|---|
| Melting Point | 50ºC |
|---|
| Molecular Formula | C9H17F6N2P |
|---|
| Molecular Weight | 153.244 |
|---|
| Exact Mass | 153.138625 |
|---|
| PSA | 22.40000 |
|---|
| LogP | 4.80350 |
|---|
| Index of Refraction | n20/D 1.423 |
|---|
| InChIKey | JWFPQAXAGSAKRF-UHFFFAOYSA-N |
|---|
| SMILES | CCCCn1cc[n+](C)c1C.F[P-](F)(F)(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 29332900 |
|---|
Synonyms
| 1-Butyl-2,3-dimethyl-1H-imidazol-3-ium hexafluorophosphate(V) |
| 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium hexafluorophosphate |
| 1-Butyl-2,3-dimethylimidazolium hexafluorophosphate |
| 1,2-dimethyl-3-butylimidazolium hexafluorophosphate |
| 1-n-butyl-2,3-dimethylimidazolium hexafluorophosphate |
| 1-Butyl-2,3-dimethyl-1H-imidazol-3-ium hexafluorophosphate |
| MFCD03790877 |
