Introduction:Basic information about CAS 892502-15-7|4-[2-(chloromethyl)-4-(trifluoromethyl)phenyl]morpholine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[2-(chloromethyl)-4-(trifluoromethyl)phenyl]morpholine |
|---|
| CAS Number | 892502-15-7 | Molecular Weight | 279.68600 |
|---|
| Density | 1.307g/cm3 | Boiling Point | 350.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H13ClF3NO | Melting Point | 52ºC |
|---|
| MSDS | / | Flash Point | 165.5ºC |
|---|
Names
| Name | 4-[2-(chloromethyl)-4-(trifluoromethyl)phenyl]morpholine |
|---|
Chemical & Physical Properties
| Density | 1.307g/cm3 |
|---|
| Boiling Point | 350.1ºC at 760 mmHg |
|---|
| Melting Point | 52ºC |
|---|
| Molecular Formula | C12H13ClF3NO |
|---|
| Molecular Weight | 279.68600 |
|---|
| Flash Point | 165.5ºC |
|---|
| Exact Mass | 279.06400 |
|---|
| PSA | 12.47000 |
|---|
| LogP | 3.34580 |
|---|
| Index of Refraction | 1.498 |
|---|
| InChIKey | KCGVSWOLBMMCMW-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(N2CCOCC2)c(CCl)c1 |
|---|