Introduction：Basic information about CAS 6094-60-6|1-benzyl-4-cyano-4-hydroxypiperidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-benzyl-4-cyano-4-hydroxypiperidine |
|---|
| CAS Number | 6094-60-6 | Molecular Weight | 216.27900 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 399.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O | Melting Point | 175-177 °C (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | 195.4ºC |
|---|
Names
| Name | 1-benzyl-4-hydroxypiperidine-4-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 399.5ºC at 760 mmHg |
|---|
| Melting Point | 175-177 °C (dec.)(lit.) |
|---|
| Molecular Formula | C13H16N2O |
|---|
| Molecular Weight | 216.27900 |
|---|
| Flash Point | 195.4ºC |
|---|
| Exact Mass | 216.12600 |
|---|
| PSA | 47.26000 |
|---|
| LogP | 1.47498 |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | XQRLXUYZKZXSBN-UHFFFAOYSA-N |
|---|
| SMILES | N#CC1(O)CCN(Cc2ccccc2)CC1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | 3276 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-Benzyl-4-hydroxy-4-cyano-piperidin |
| HMS560J12 |
| 1-benzyl-4-hydroxy-piperidin-4-carbonitrile |
| 4-Cyano-4-hydroxy-1-benzylpiperidin |
| 1-benzyl-4-hydroxy-piperidine-4-carbonitrile |
| 1-Benzyl-4-hydroxy-4-piperidinecarbonitrile |
| 1-Benzyl-4-cyano-4-hydroxypiperidine |
| EINECS 228-043-2 |
| MFCD00023752 |
