Introduction:Basic information about CAS 174627-31-7|8-Isopropyl-4,6,7-trimethoxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-Isopropyl-4,6,7-trimethoxy-2-naphthoic acid |
|---|
| CAS Number | 174627-31-7 | Molecular Weight | 304.33800 |
|---|
| Density | 1.179g/cm3 | Boiling Point | 458.945ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164.795ºC |
|---|
Names
| Name | 8-Isopropyl-4,6,7-trimethoxy-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Density | 1.179g/cm3 |
|---|
| Boiling Point | 458.945ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20O5 |
|---|
| Molecular Weight | 304.33800 |
|---|
| Flash Point | 164.795ºC |
|---|
| Exact Mass | 304.13100 |
|---|
| PSA | 64.99000 |
|---|
| LogP | 3.68720 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | SEPGZJCSICALKT-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2c(OC)cc(C(=O)O)cc2c(C(C)C)c1OC |
|---|