Introduction:Basic information about CAS 175161-43-0|7-Chloro-4-hydroxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Chloro-4-hydroxy-2-naphthoic acid |
|---|
| CAS Number | 175161-43-0 | Molecular Weight | 222.62400 |
|---|
| Density | 1.52g/cm3 | Boiling Point | 442.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.3ºC |
|---|
Names
| Name | 7-Chloro-4-hydroxy-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Boiling Point | 442.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7ClO3 |
|---|
| Molecular Weight | 222.62400 |
|---|
| Flash Point | 221.3ºC |
|---|
| Exact Mass | 222.00800 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 2.89700 |
|---|
| Vapour Pressure | 1.34E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.719 |
|---|
| InChIKey | BSPGZVDOEMRJOG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(O)c2ccc(Cl)cc2c1 |
|---|