Introduction：Basic information about CAS 178876-99-8|2-Naphthalenecarboxylic acid, 7-bromo-4-hydroxy-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Naphthalenecarboxylic acid, 7-bromo-4-hydroxy-, ethyl ester |
|---|
| CAS Number | 178876-99-8 | Molecular Weight | 295.12900 |
|---|
| Density | 1.533g/cm3 | Boiling Point | 450.24ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11BrO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.098ºC |
|---|
Names
| Name | Ethyl 7-bromo-4-hydroxy-2-naphthoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.533g/cm3 |
|---|
| Boiling Point | 450.24ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11BrO3 |
|---|
| Molecular Weight | 295.12900 |
|---|
| Flash Point | 226.098ºC |
|---|
| Exact Mass | 293.98900 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.48460 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.648 |
|---|
| InChIKey | VEWIXWCOUVXFFG-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(O)c2ccc(Br)cc2c1 |
|---|
| Storage condition | 2-8°C, stored under nitrogen |
|---|
Synonyms
| ethyl 4-hydroxy-7-bromo-2-naphthoate |
| ethyl 7-bromo-3-hydroxy-2-naphthoate |
| ethyl 7-bromo-3-hydroxynaphthalen-2-carboxylate |
| ethyl 7-Bromo-4-hydroxy-2-naphthalenecarboxylate |
