Introduction：Basic information about CAS 178877-04-8|Ethyl 4-(benzyloxy)-7-cyano-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-(benzyloxy)-7-cyano-2-naphthoate |
|---|
| CAS Number | 178877-04-8 | Molecular Weight | 331.36500 |
|---|
| Density | 1.238g/cm3 | Boiling Point | 524.671ºC at 760 mmHg |
|---|
| Molecular Formula | C21H17NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.818ºC |
|---|
Names
| Name | Ethyl 4-(benzyloxy)-7-cyano-2-naphthoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.238g/cm3 |
|---|
| Boiling Point | 524.671ºC at 760 mmHg |
|---|
| Molecular Formula | C21H17NO3 |
|---|
| Molecular Weight | 331.36500 |
|---|
| Flash Point | 226.818ºC |
|---|
| Exact Mass | 331.12100 |
|---|
| PSA | 59.32000 |
|---|
| LogP | 4.46718 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | RPHGKNFYBZWEEL-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OCc2ccccc2)c2ccc(C#N)cc2c1 |
|---|
Synonyms
| ethyl 4-benzyloxy-5,8-dimethoxy-2-naphthoate |
| ethyl 4-Benzyloxy-7-cyano-2-naphthalenecarboxylate |
| 4-benzyloxy-3-oxo-butyric acid ethyl ester |
| ethyl 4-benzyloxy-3-oxobutyrate |
| 4-benzyloxyacetoacetic ethyl ester |
| ethyl 1-benzyloxy-6-cyano-3-naphthalenecarboxylate |
| ethyl 4-benzyloxyacetoacetate |
