Introduction：Basic information about CAS 218961-12-7|Ethyl 6-cyano-4-hydroxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 6-cyano-4-hydroxy-2-naphthoate |
|---|
| CAS Number | 218961-12-7 | Molecular Weight | 241.24200 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 474.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.7ºC |
|---|
Names
| Name | Ethyl 6-cyano-4-hydroxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 474.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11NO3 |
|---|
| Molecular Weight | 241.24200 |
|---|
| Flash Point | 240.7ºC |
|---|
| Exact Mass | 241.07400 |
|---|
| PSA | 70.32000 |
|---|
| LogP | 2.59378 |
|---|
| Vapour Pressure | 1.28E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | FRIGEDZXVYWFPY-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(O)c2cc(C#N)ccc2c1 |
|---|
