Introduction:Basic information about CAS 222535-05-9|Ethyl 4-(benzyloxy)-6-nitro-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-(benzyloxy)-6-nitro-2-naphthoate |
|---|
| CAS Number | 222535-05-9 | Molecular Weight | 351.35300 |
|---|
| Density | 1.279g/cm3 | Boiling Point | 532.4ºC at 760 mmHg |
|---|
| Molecular Formula | C20H17NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 219.2ºC |
|---|
Names
| Name | Ethyl 4-(benzyloxy)-6-nitro-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.279g/cm3 |
|---|
| Boiling Point | 532.4ºC at 760 mmHg |
|---|
| Molecular Formula | C20H17NO5 |
|---|
| Molecular Weight | 351.35300 |
|---|
| Flash Point | 219.2ºC |
|---|
| Exact Mass | 351.11100 |
|---|
| PSA | 81.35000 |
|---|
| LogP | 5.02690 |
|---|
| Vapour Pressure | 2.04E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | NOHIXTMFNGJRTP-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OCc2ccccc2)c2cc([N+](=O)[O-])ccc2c1 |
|---|